C22H17BrClN3O3 — CID 4084219
5-[[3-bromo-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-1,3-dihydrobenzimidazol-2-one (PubChem CID 4084219) has the molecular formula C22H17BrClN3O3 and a molecular weight of 486.75 g/mol. Its IUPAC name is 5-[[3-bromo-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-1,3-dihydrobenzimidazol-2-one.
| Compound Name | 5-[[3-bromo-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-1,3-dihydrobenzimidazol-2-one |
|---|---|
| PubChem CID | 4084219 |
| Molecular Formula | C22H17BrClN3O3 |
| Molecular Weight | 486.75 g/mol |
| Exact Mass | 485.01 |
| IUPAC Name | 5-[[3-bromo-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-1,3-dihydrobenzimidazol-2-one |
| SMILES | COc1cc(/C=N/c2ccc3[nH]c(=O)[nH]c3c2)cc(Br)c1OCc1ccccc1Cl |
| InChI | InChI=1S/C22H17BrClN3O3/c1-29-20-9-13(11-25-15-6-7-18-19(10-15)27-22(28)26-18)8-16(23)21(20)30-12-14-4-2-3-5-17(14)24/h2-11H,12H2,1H3,(H2,26,27,28)/b25-11+ |
| InChIKey | YLJJPOONMRGHEF-OPEKNORGSA-N |
| XLogP | 5.61 |
| TPSA | 79.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.75 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|