C16H15Br2NO3 — CID 5024698
3,4-dibromo-6-ethoxy-2-[(2-hydroxy-5-methylphenyl)iminomethyl]phenol (PubChem CID 5024698) has the molecular formula C16H15Br2NO3 and a molecular weight of 429.11 g/mol. Its IUPAC name is 3,4-dibromo-6-ethoxy-2-[(2-hydroxy-5-methylphenyl)iminomethyl]phenol.
| Compound Name | 3,4-dibromo-6-ethoxy-2-[(2-hydroxy-5-methylphenyl)iminomethyl]phenol |
|---|---|
| PubChem CID | 5024698 |
| Molecular Formula | C16H15Br2NO3 |
| Molecular Weight | 429.11 g/mol |
| Exact Mass | 426.94 |
| IUPAC Name | 3,4-dibromo-6-ethoxy-2-[(2-hydroxy-5-methylphenyl)iminomethyl]phenol |
| SMILES | CCOc1cc(Br)c(Br)c(/C=N/c2cc(C)ccc2O)c1O |
| InChI | InChI=1S/C16H15Br2NO3/c1-3-22-14-7-11(17)15(18)10(16(14)21)8-19-12-6-9(2)4-5-13(12)20/h4-8,20-21H,3H2,1-2H3/b19-8+ |
| InChIKey | OADNHGRHBUIBDW-UFWORHAWSA-N |
| XLogP | 5.08 |
| TPSA | 62.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.11 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|