C16H16Br2N2O4S — CID 135891670
N-[(Z)-(2,3-dibromo-5-ethoxy-6-hydroxyphenyl)methylideneamino]-4-methylbenzenesulfonamide (PubChem CID 135891670) has the molecular formula C16H16Br2N2O4S and a molecular weight of 492.19 g/mol. Its IUPAC name is N-[(Z)-(2,3-dibromo-5-ethoxy-6-hydroxyphenyl)methylideneamino]-4-methylbenzenesulfonamide.
| Compound Name | N-[(Z)-(2,3-dibromo-5-ethoxy-6-hydroxyphenyl)methylideneamino]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 135891670 |
| Molecular Formula | C16H16Br2N2O4S |
| Molecular Weight | 492.19 g/mol |
| Exact Mass | 489.92 |
| IUPAC Name | N-[(Z)-(2,3-dibromo-5-ethoxy-6-hydroxyphenyl)methylideneamino]-4-methylbenzenesulfonamide |
| SMILES | CCOc1cc(Br)c(Br)c(/C=N\NS(=O)(=O)c2ccc(C)cc2)c1O |
| InChI | InChI=1S/C16H16Br2N2O4S/c1-3-24-14-8-13(17)15(18)12(16(14)21)9-19-20-25(22,23)11-6-4-10(2)5-7-11/h4-9,20-21H,3H2,1-2H3/b19-9- |
| InChIKey | OAWTXGOJCQAXDT-OCKHKDLRSA-N |
| XLogP | 3.94 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.19 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|