C16H11Br3F3NO2 — CID 135588655
3,4-dibromo-2-[[2-bromo-5-(trifluoromethyl)phenyl]iminomethyl]-6-ethoxyphenol (PubChem CID 135588655) has the molecular formula C16H11Br3F3NO2 and a molecular weight of 545.98 g/mol. Its IUPAC name is 3,4-dibromo-2-[[2-bromo-5-(trifluoromethyl)phenyl]iminomethyl]-6-ethoxyphenol.
| Compound Name | 3,4-dibromo-2-[[2-bromo-5-(trifluoromethyl)phenyl]iminomethyl]-6-ethoxyphenol |
|---|---|
| PubChem CID | 135588655 |
| Molecular Formula | C16H11Br3F3NO2 |
| Molecular Weight | 545.98 g/mol |
| Exact Mass | 542.83 |
| IUPAC Name | 3,4-dibromo-2-[[2-bromo-5-(trifluoromethyl)phenyl]iminomethyl]-6-ethoxyphenol |
| SMILES | CCOc1cc(Br)c(Br)c(/C=N/c2cc(C(F)(F)F)ccc2Br)c1O |
| InChI | InChI=1S/C16H11Br3F3NO2/c1-2-25-13-6-11(18)14(19)9(15(13)24)7-23-12-5-8(16(20,21)22)3-4-10(12)17/h3-7,24H,2H2,1H3/b23-7+ |
| InChIKey | VNVIVOJAIDGYEC-HCGXMYGOSA-N |
| XLogP | 6.85 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.98 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|