C14H11F3N4S — CID 171983956
4-(1H-indol-3-yl)-N-[(E)-1,1,1-trifluoropropan-2-ylideneamino]-1,3-thiazol-2-amine (PubChem CID 171983956) has the molecular formula C14H11F3N4S and a molecular weight of 324.33 g/mol. Its IUPAC name is 4-(1H-indol-3-yl)-N-[(E)-1,1,1-trifluoropropan-2-ylideneamino]-1,3-thiazol-2-amine.
| Compound Name | 4-(1H-indol-3-yl)-N-[(E)-1,1,1-trifluoropropan-2-ylideneamino]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 171983956 |
| Molecular Formula | C14H11F3N4S |
| Molecular Weight | 324.33 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | 4-(1H-indol-3-yl)-N-[(E)-1,1,1-trifluoropropan-2-ylideneamino]-1,3-thiazol-2-amine |
| SMILES | C/C(=N\Nc1nc(-c2c[nH]c3ccccc23)cs1)C(F)(F)F |
| InChI | InChI=1S/C14H11F3N4S/c1-8(14(15,16)17)20-21-13-19-12(7-22-13)10-6-18-11-5-3-2-4-9(10)11/h2-7,18H,1H3,(H,19,21)/b20-8+ |
| InChIKey | OGHJEQWGKOKJKV-DNTJNYDQSA-N |
| XLogP | 4.64 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.33 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|