C19H21N3S — CID 6923298
N-[[(7aR)-4-methyl-1,2,3,6,7,7a-hexahydroinden-5-ylidene]amino]-4-phenyl-1,3-thiazol-2-amine (PubChem CID 6923298) has the molecular formula C19H21N3S and a molecular weight of 323.46 g/mol. Its IUPAC name is N-[[(7aR)-4-methyl-1,2,3,6,7,7a-hexahydroinden-5-ylidene]amino]-4-phenyl-1,3-thiazol-2-amine.
| Compound Name | N-[[(7aR)-4-methyl-1,2,3,6,7,7a-hexahydroinden-5-ylidene]amino]-4-phenyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 6923298 |
| Molecular Formula | C19H21N3S |
| Molecular Weight | 323.46 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | N-[[(7aR)-4-methyl-1,2,3,6,7,7a-hexahydroinden-5-ylidene]amino]-4-phenyl-1,3-thiazol-2-amine |
| SMILES | CC1=C2CCC[C@@H]2CCC1=NNc1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C19H21N3S/c1-13-16-9-5-8-14(16)10-11-17(13)21-22-19-20-18(12-23-19)15-6-3-2-4-7-15/h2-4,6-7,12,14H,5,8-11H2,1H3,(H,20,22)/t14-/m1/s1 |
| InChIKey | LNHZDARYSGKXNW-CQSZACIVSA-N |
| XLogP | 5.49 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.46 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|