C16H16N2OS — CID 5080547
2-[[(4-phenyl-1,3-thiazol-2-yl)amino]methylidene]cyclohexan-1-one (PubChem CID 5080547) has the molecular formula C16H16N2OS and a molecular weight of 284.38 g/mol. Its IUPAC name is 2-[[(4-phenyl-1,3-thiazol-2-yl)amino]methylidene]cyclohexan-1-one.
| Compound Name | 2-[[(4-phenyl-1,3-thiazol-2-yl)amino]methylidene]cyclohexan-1-one |
|---|---|
| PubChem CID | 5080547 |
| Molecular Formula | C16H16N2OS |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 2-[[(4-phenyl-1,3-thiazol-2-yl)amino]methylidene]cyclohexan-1-one |
| SMILES | O=C1CCCCC1=CNc1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C16H16N2OS/c19-15-9-5-4-8-13(15)10-17-16-18-14(11-20-16)12-6-2-1-3-7-12/h1-3,6-7,10-11H,4-5,8-9H2,(H,17,18) |
| InChIKey | GHOLYOHZNKOIJD-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|