C32H22Br2N4NiO2S2 — CID 6826302
bis(4-bromo-6-[[(4-phenyl-1,3-thiazol-2-yl)amino]methylidene]cyclohexa-2,4-dien-1-one);nickel (PubChem CID 6826302) has the molecular formula C32H22Br2N4NiO2S2 and a molecular weight of 777.19 g/mol. Its IUPAC name is bis(4-bromo-6-[[(4-phenyl-1,3-thiazol-2-yl)amino]methylidene]cyclohexa-2,4-dien-1-one);nickel.
| Compound Name | bis(4-bromo-6-[[(4-phenyl-1,3-thiazol-2-yl)amino]methylidene]cyclohexa-2,4-dien-1-one);nickel |
|---|---|
| PubChem CID | 6826302 |
| Molecular Formula | C32H22Br2N4NiO2S2 |
| Molecular Weight | 777.19 g/mol |
| Exact Mass | 773.89 |
| IUPAC Name | bis(4-bromo-6-[[(4-phenyl-1,3-thiazol-2-yl)amino]methylidene]cyclohexa-2,4-dien-1-one);nickel |
| SMILES | O=C1C=CC(Br)=CC1=CNc1nc(-c2ccccc2)cs1.O=C1C=CC(Br)=CC1=CNc1nc(-c2ccccc2)cs1.[Ni] |
| InChI | InChI=1S/2C16H11BrN2OS.Ni/c2*17-13-6-7-15(20)12(8-13)9-18-16-19-14(10-21-16)11-4-2-1-3-5-11;/h2*1-10H,(H,18,19); |
| InChIKey | WHTBXNPNRXSDNK-UHFFFAOYSA-N |
| XLogP | 9.04 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 777.19 |
| LogP ≤ 5 | 9.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|