C32H20Br4N4O2S2Zn — CID 6798239
bis(2,4-dibromo-6-[[(4-phenyl-1,3-thiazol-2-yl)amino]methylidene]cyclohexa-2,4-dien-1-one);zinc (PubChem CID 6798239) has the molecular formula C32H20Br4N4O2S2Zn and a molecular weight of 941.68 g/mol. Its IUPAC name is bis(2,4-dibromo-6-[[(4-phenyl-1,3-thiazol-2-yl)amino]methylidene]cyclohexa-2,4-dien-1-one);zinc.
| Compound Name | bis(2,4-dibromo-6-[[(4-phenyl-1,3-thiazol-2-yl)amino]methylidene]cyclohexa-2,4-dien-1-one);zinc |
|---|---|
| PubChem CID | 6798239 |
| Molecular Formula | C32H20Br4N4O2S2Zn |
| Molecular Weight | 941.68 g/mol |
| Exact Mass | 935.71 |
| IUPAC Name | bis(2,4-dibromo-6-[[(4-phenyl-1,3-thiazol-2-yl)amino]methylidene]cyclohexa-2,4-dien-1-one);zinc |
| SMILES | O=C1C(Br)=CC(Br)=CC1=CNc1nc(-c2ccccc2)cs1.O=C1C(Br)=CC(Br)=CC1=CNc1nc(-c2ccccc2)cs1.[Zn] |
| InChI | InChI=1S/2C16H10Br2N2OS.Zn/c2*17-12-6-11(15(21)13(18)7-12)8-19-16-20-14(9-22-16)10-4-2-1-3-5-10;/h2*1-9H,(H,19,20); |
| InChIKey | XEYURSQILZMTES-UHFFFAOYSA-N |
| XLogP | 10.49 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 941.68 |
| LogP ≤ 5 | 10.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|