C32H20Br4N4NiO2S2 — CID 6787817
bis(2,4-dibromo-6-[[(4-phenyl-1,3-thiazol-2-yl)amino]methylidene]cyclohexa-2,4-dien-1-one);nickel (PubChem CID 6787817) has the molecular formula C32H20Br4N4NiO2S2 and a molecular weight of 934.98 g/mol. Its IUPAC name is bis(2,4-dibromo-6-[[(4-phenyl-1,3-thiazol-2-yl)amino]methylidene]cyclohexa-2,4-dien-1-one);nickel.
| Compound Name | bis(2,4-dibromo-6-[[(4-phenyl-1,3-thiazol-2-yl)amino]methylidene]cyclohexa-2,4-dien-1-one);nickel |
|---|---|
| PubChem CID | 6787817 |
| Molecular Formula | C32H20Br4N4NiO2S2 |
| Molecular Weight | 934.98 g/mol |
| Exact Mass | 929.71 |
| IUPAC Name | bis(2,4-dibromo-6-[[(4-phenyl-1,3-thiazol-2-yl)amino]methylidene]cyclohexa-2,4-dien-1-one);nickel |
| SMILES | O=C1C(Br)=CC(Br)=CC1=CNc1nc(-c2ccccc2)cs1.O=C1C(Br)=CC(Br)=CC1=CNc1nc(-c2ccccc2)cs1.[Ni] |
| InChI | InChI=1S/2C16H10Br2N2OS.Ni/c2*17-12-6-11(15(21)13(18)7-12)8-19-16-20-14(9-22-16)10-4-2-1-3-5-10;/h2*1-9H,(H,19,20); |
| InChIKey | YWGFMMJCRHFQAL-UHFFFAOYSA-N |
| XLogP | 10.49 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 934.98 |
| LogP ≤ 5 | 10.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|