C20H25N3O5S — CID 110529575
4-(3-methoxy-5-nitro-4-pentoxyphenyl)-2-sulfanylidene-1,3,4,6,7,8-hexahydroquinazolin-5-one (PubChem CID 110529575) has the molecular formula C20H25N3O5S and a molecular weight of 419.50 g/mol. Its IUPAC name is 4-(3-methoxy-5-nitro-4-pentoxyphenyl)-2-sulfanylidene-1,3,4,6,7,8-hexahydroquinazolin-5-one.
| Compound Name | 4-(3-methoxy-5-nitro-4-pentoxyphenyl)-2-sulfanylidene-1,3,4,6,7,8-hexahydroquinazolin-5-one |
|---|---|
| PubChem CID | 110529575 |
| Molecular Formula | C20H25N3O5S |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | 4-(3-methoxy-5-nitro-4-pentoxyphenyl)-2-sulfanylidene-1,3,4,6,7,8-hexahydroquinazolin-5-one |
| SMILES | CCCCCOc1c(OC)cc(C2NC(=S)NC3=C2C(=O)CCC3)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H25N3O5S/c1-3-4-5-9-28-19-14(23(25)26)10-12(11-16(19)27-2)18-17-13(21-20(29)22-18)7-6-8-15(17)24/h10-11,18H,3-9H2,1-2H3,(H2,21,22,29) |
| InChIKey | OCFXZIYVBHDAHE-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 102.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|