C40H43ClN2O5 — CID 126277737
2-[4-(10-benzyl-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl)-2-ethoxyphenoxy]-N-(2-chlorophenyl)acetamide (PubChem CID 126277737) has the molecular formula C40H43ClN2O5 and a molecular weight of 667.25 g/mol. Its IUPAC name is 2-[4-(10-benzyl-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl)-2-ethoxyphenoxy]-N-(2-chlorophenyl)acetamide.
| Compound Name | 2-[4-(10-benzyl-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl)-2-ethoxyphenoxy]-N-(2-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 126277737 |
| Molecular Formula | C40H43ClN2O5 |
| Molecular Weight | 667.25 g/mol |
| Exact Mass | 666.29 |
| IUPAC Name | 2-[4-(10-benzyl-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl)-2-ethoxyphenoxy]-N-(2-chlorophenyl)acetamide |
| SMILES | CCOc1cc(C2C3=C(CC(C)(C)CC3=O)N(Cc3ccccc3)C3=C2C(=O)CC(C)(C)C3)ccc1OCC(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C40H43ClN2O5/c1-6-47-34-18-26(16-17-33(34)48-24-35(46)42-28-15-11-10-14-27(28)41)36-37-29(19-39(2,3)21-31(37)44)43(23-25-12-8-7-9-13-25)30-20-40(4,5)22-32(45)38(30)36/h7-18,36H,6,19-24H2,1-5H3,(H,42,46) |
| InChIKey | VDQQZEYWPMVYHT-UHFFFAOYSA-N |
| XLogP | 8.64 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.25 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |