C25H28ClNO5 — CID 126077067
2-[2-chloro-4-(3,3,6,6-tetramethyl-1,8-dioxo-2,4,5,7,9,10-hexahydroacridin-9-yl)phenoxy]acetic acid (PubChem CID 126077067) has the molecular formula C25H28ClNO5 and a molecular weight of 457.95 g/mol. Its IUPAC name is 2-[2-chloro-4-(3,3,6,6-tetramethyl-1,8-dioxo-2,4,5,7,9,10-hexahydroacridin-9-yl)phenoxy]acetic acid.
| Compound Name | 2-[2-chloro-4-(3,3,6,6-tetramethyl-1,8-dioxo-2,4,5,7,9,10-hexahydroacridin-9-yl)phenoxy]acetic acid |
|---|---|
| PubChem CID | 126077067 |
| Molecular Formula | C25H28ClNO5 |
| Molecular Weight | 457.95 g/mol |
| Exact Mass | 457.17 |
| IUPAC Name | 2-[2-chloro-4-(3,3,6,6-tetramethyl-1,8-dioxo-2,4,5,7,9,10-hexahydroacridin-9-yl)phenoxy]acetic acid |
| SMILES | CC1(C)CC(=O)C2=C(C1)NC1=C(C(=O)CC(C)(C)C1)C2c1ccc(OCC(=O)O)c(Cl)c1 |
| InChI | InChI=1S/C25H28ClNO5/c1-24(2)8-15-22(17(28)10-24)21(23-16(27-15)9-25(3,4)11-18(23)29)13-5-6-19(14(26)7-13)32-12-20(30)31/h5-7,21,27H,8-12H2,1-4H3,(H,30,31) |
| InChIKey | LRMYMMVUBQNCTM-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.95 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |