C29H30ClNO2 — CID 22117821
9-(4-chloro-3-phenylphenyl)-3,3,6,6-tetramethyl-2,4,5,7,9,10-hexahydroacridine-1,8-dione (PubChem CID 22117821) has the molecular formula C29H30ClNO2 and a molecular weight of 460.02 g/mol. Its IUPAC name is 9-(4-chloro-3-phenylphenyl)-3,3,6,6-tetramethyl-2,4,5,7,9,10-hexahydroacridine-1,8-dione.
| Compound Name | 9-(4-chloro-3-phenylphenyl)-3,3,6,6-tetramethyl-2,4,5,7,9,10-hexahydroacridine-1,8-dione |
|---|---|
| PubChem CID | 22117821 |
| Molecular Formula | C29H30ClNO2 |
| Molecular Weight | 460.02 g/mol |
| Exact Mass | 459.20 |
| IUPAC Name | 9-(4-chloro-3-phenylphenyl)-3,3,6,6-tetramethyl-2,4,5,7,9,10-hexahydroacridine-1,8-dione |
| SMILES | CC1(C)CC(=O)C2=C(C1)NC1=C(C(=O)CC(C)(C)C1)C2c1ccc(Cl)c(-c2ccccc2)c1 |
| InChI | InChI=1S/C29H30ClNO2/c1-28(2)13-21-26(23(32)15-28)25(27-22(31-21)14-29(3,4)16-24(27)33)18-10-11-20(30)19(12-18)17-8-6-5-7-9-17/h5-12,25,31H,13-16H2,1-4H3 |
| InChIKey | VMBIJPQDOLTMHE-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.02 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |