C36H42N2O2 — CID 91670571
9-(1-benzyl-2,2,4-trimethylquinolin-6-yl)-3,3,6,6-tetramethyl-2,4,5,7,9,10-hexahydroacridine-1,8-dione (PubChem CID 91670571) has the molecular formula C36H42N2O2 and a molecular weight of 534.74 g/mol. Its IUPAC name is 9-(1-benzyl-2,2,4-trimethylquinolin-6-yl)-3,3,6,6-tetramethyl-2,4,5,7,9,10-hexahydroacridine-1,8-dione.
| Compound Name | 9-(1-benzyl-2,2,4-trimethylquinolin-6-yl)-3,3,6,6-tetramethyl-2,4,5,7,9,10-hexahydroacridine-1,8-dione |
|---|---|
| PubChem CID | 91670571 |
| Molecular Formula | C36H42N2O2 |
| Molecular Weight | 534.74 g/mol |
| Exact Mass | 534.32 |
| IUPAC Name | 9-(1-benzyl-2,2,4-trimethylquinolin-6-yl)-3,3,6,6-tetramethyl-2,4,5,7,9,10-hexahydroacridine-1,8-dione |
| SMILES | CC1=CC(C)(C)N(Cc2ccccc2)c2ccc(C3C4=C(CC(C)(C)CC4=O)NC4=C3C(=O)CC(C)(C)C4)cc21 |
| InChI | InChI=1S/C36H42N2O2/c1-22-16-36(6,7)38(21-23-11-9-8-10-12-23)28-14-13-24(15-25(22)28)31-32-26(17-34(2,3)19-29(32)39)37-27-18-35(4,5)20-30(40)33(27)31/h8-16,31,37H,17-21H2,1-7H3 |
| InChIKey | BMNOFCPGILAWEY-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.74 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |