C33H37ClN2O4 — CID 126266328
2-[4-chloro-2-(3,3,6,6-tetramethyl-1,8-dioxo-2,4,5,7,9,10-hexahydroacridin-9-yl)phenoxy]-N-(2,5-dimethylphenyl)acetamide (PubChem CID 126266328) has the molecular formula C33H37ClN2O4 and a molecular weight of 561.12 g/mol. Its IUPAC name is 2-[4-chloro-2-(3,3,6,6-tetramethyl-1,8-dioxo-2,4,5,7,9,10-hexahydroacridin-9-yl)phenoxy]-N-(2,5-dimethylphenyl)acetamide.
| Compound Name | 2-[4-chloro-2-(3,3,6,6-tetramethyl-1,8-dioxo-2,4,5,7,9,10-hexahydroacridin-9-yl)phenoxy]-N-(2,5-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 126266328 |
| Molecular Formula | C33H37ClN2O4 |
| Molecular Weight | 561.12 g/mol |
| Exact Mass | 560.24 |
| IUPAC Name | 2-[4-chloro-2-(3,3,6,6-tetramethyl-1,8-dioxo-2,4,5,7,9,10-hexahydroacridin-9-yl)phenoxy]-N-(2,5-dimethylphenyl)acetamide |
| SMILES | Cc1ccc(C)c(NC(=O)COc2ccc(Cl)cc2C2C3=C(CC(C)(C)CC3=O)NC3=C2C(=O)CC(C)(C)C3)c1 |
| InChI | InChI=1S/C33H37ClN2O4/c1-18-7-8-19(2)22(11-18)36-28(39)17-40-27-10-9-20(34)12-21(27)29-30-23(13-32(3,4)15-25(30)37)35-24-14-33(5,6)16-26(38)31(24)29/h7-12,29,35H,13-17H2,1-6H3,(H,36,39) |
| InChIKey | LRHRTGJYWLKVQT-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.12 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |