C29H30INO3 — CID 71568453
9-(3-hydroxyphenyl)-10-(2-iodophenyl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione (PubChem CID 71568453) has the molecular formula C29H30INO3 and a molecular weight of 567.47 g/mol. Its IUPAC name is 9-(3-hydroxyphenyl)-10-(2-iodophenyl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione.
| Compound Name | 9-(3-hydroxyphenyl)-10-(2-iodophenyl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione |
|---|---|
| PubChem CID | 71568453 |
| Molecular Formula | C29H30INO3 |
| Molecular Weight | 567.47 g/mol |
| Exact Mass | 567.13 |
| IUPAC Name | 9-(3-hydroxyphenyl)-10-(2-iodophenyl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione |
| SMILES | CC1(C)CC(=O)C2=C(C1)N(c1ccccc1I)C1=C(C(=O)CC(C)(C)C1)C2c1cccc(O)c1 |
| InChI | InChI=1S/C29H30INO3/c1-28(2)13-21-26(23(33)15-28)25(17-8-7-9-18(32)12-17)27-22(14-29(3,4)16-24(27)34)31(21)20-11-6-5-10-19(20)30/h5-12,25,32H,13-16H2,1-4H3 |
| InChIKey | PXQPTUOKHUMQIF-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.47 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|