C29H37FN2O3 — CID 3245535
9-(3-fluorophenyl)-3,3,6,6-tetramethyl-10-(2-morpholin-4-ylethyl)-4,5,7,9-tetrahydro-2H-acridine-1,8-dione (PubChem CID 3245535) has the molecular formula C29H37FN2O3 and a molecular weight of 480.62 g/mol. Its IUPAC name is 9-(3-fluorophenyl)-3,3,6,6-tetramethyl-10-(2-morpholin-4-ylethyl)-4,5,7,9-tetrahydro-2H-acridine-1,8-dione.
| Compound Name | 9-(3-fluorophenyl)-3,3,6,6-tetramethyl-10-(2-morpholin-4-ylethyl)-4,5,7,9-tetrahydro-2H-acridine-1,8-dione |
|---|---|
| PubChem CID | 3245535 |
| Molecular Formula | C29H37FN2O3 |
| Molecular Weight | 480.62 g/mol |
| Exact Mass | 480.28 |
| IUPAC Name | 9-(3-fluorophenyl)-3,3,6,6-tetramethyl-10-(2-morpholin-4-ylethyl)-4,5,7,9-tetrahydro-2H-acridine-1,8-dione |
| SMILES | CC1(C)CC(=O)C2=C(C1)N(CCN1CCOCC1)C1=C(C(=O)CC(C)(C)C1)C2c1cccc(F)c1 |
| InChI | InChI=1S/C29H37FN2O3/c1-28(2)15-21-26(23(33)17-28)25(19-6-5-7-20(30)14-19)27-22(16-29(3,4)18-24(27)34)32(21)9-8-31-10-12-35-13-11-31/h5-7,14,25H,8-13,15-18H2,1-4H3 |
| InChIKey | VAVQQQLCEHCQFJ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.62 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |