C26H27ClO4 — CID 2296218
9-(5-chloro-2-prop-2-ynoxyphenyl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-xanthene-1,8-dione (PubChem CID 2296218) has the molecular formula C26H27ClO4 and a molecular weight of 438.95 g/mol. Its IUPAC name is 9-(5-chloro-2-prop-2-ynoxyphenyl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-xanthene-1,8-dione.
| Compound Name | 9-(5-chloro-2-prop-2-ynoxyphenyl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-xanthene-1,8-dione |
|---|---|
| PubChem CID | 2296218 |
| Molecular Formula | C26H27ClO4 |
| Molecular Weight | 438.95 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | 9-(5-chloro-2-prop-2-ynoxyphenyl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-xanthene-1,8-dione |
| SMILES | C#CCOc1ccc(Cl)cc1C1C2=C(CC(C)(C)CC2=O)OC2=C1C(=O)CC(C)(C)C2 |
| InChI | InChI=1S/C26H27ClO4/c1-6-9-30-19-8-7-15(27)10-16(19)22-23-17(28)11-25(2,3)13-20(23)31-21-14-26(4,5)12-18(29)24(21)22/h1,7-8,10,22H,9,11-14H2,2-5H3 |
| InChIKey | DCFTYIGRTLMJLM-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.95 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|