C10H9F3N2O3 — CID 171252592
(4R)-4-[2-hydroxy-5-(trifluoromethoxy)phenyl]imidazolidin-2-one (PubChem CID 171252592) has the molecular formula C10H9F3N2O3 and a molecular weight of 262.19 g/mol. Its IUPAC name is (4R)-4-[2-hydroxy-5-(trifluoromethoxy)phenyl]imidazolidin-2-one.
| Compound Name | (4R)-4-[2-hydroxy-5-(trifluoromethoxy)phenyl]imidazolidin-2-one |
|---|---|
| PubChem CID | 171252592 |
| Molecular Formula | C10H9F3N2O3 |
| Molecular Weight | 262.19 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | (4R)-4-[2-hydroxy-5-(trifluoromethoxy)phenyl]imidazolidin-2-one |
| SMILES | O=C1NC[C@@H](c2cc(OC(F)(F)F)ccc2O)N1 |
| InChI | InChI=1S/C10H9F3N2O3/c11-10(12,13)18-5-1-2-8(16)6(3-5)7-4-14-9(17)15-7/h1-3,7,16H,4H2,(H2,14,15,17)/t7-/m0/s1 |
| InChIKey | ARCRZIKKXPNPMJ-ZETCQYMHSA-N |
| XLogP | 1.64 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.19 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|