C11H10F4N2O2 — CID 171252567
(4R)-4-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]imidazolidin-2-one (PubChem CID 171252567) has the molecular formula C11H10F4N2O2 and a molecular weight of 278.21 g/mol. Its IUPAC name is (4R)-4-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]imidazolidin-2-one.
| Compound Name | (4R)-4-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]imidazolidin-2-one |
|---|---|
| PubChem CID | 171252567 |
| Molecular Formula | C11H10F4N2O2 |
| Molecular Weight | 278.21 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | (4R)-4-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]imidazolidin-2-one |
| SMILES | O=C1NC[C@@H](c2ccc(OC(F)(F)C(F)F)cc2)N1 |
| InChI | InChI=1S/C11H10F4N2O2/c12-9(13)11(14,15)19-7-3-1-6(2-4-7)8-5-16-10(18)17-8/h1-4,8-9H,5H2,(H2,16,17,18)/t8-/m0/s1 |
| InChIKey | BSWCCKXZVUBKNI-QMMMGPOBSA-N |
| XLogP | 2.28 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.21 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|