C10H8F4N2O — CID 171252694
(4S)-4-[4-fluoro-3-(trifluoromethyl)phenyl]imidazolidin-2-one (PubChem CID 171252694) has the molecular formula C10H8F4N2O and a molecular weight of 248.18 g/mol. Its IUPAC name is (4S)-4-[4-fluoro-3-(trifluoromethyl)phenyl]imidazolidin-2-one.
| Compound Name | (4S)-4-[4-fluoro-3-(trifluoromethyl)phenyl]imidazolidin-2-one |
|---|---|
| PubChem CID | 171252694 |
| Molecular Formula | C10H8F4N2O |
| Molecular Weight | 248.18 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | (4S)-4-[4-fluoro-3-(trifluoromethyl)phenyl]imidazolidin-2-one |
| SMILES | O=C1NC[C@H](c2ccc(F)c(C(F)(F)F)c2)N1 |
| InChI | InChI=1S/C10H8F4N2O/c11-7-2-1-5(3-6(7)10(12,13)14)8-4-15-9(17)16-8/h1-3,8H,4H2,(H2,15,16,17)/t8-/m1/s1 |
| InChIKey | HKGKFGCCJVKURM-MRVPVSSYSA-N |
| XLogP | 2.20 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.18 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |