C13H13F4NO2 — CID 107290045
6-[4-fluoro-3-(trifluoromethyl)phenyl]piperidine-2-carboxylic acid (PubChem CID 107290045) has the molecular formula C13H13F4NO2 and a molecular weight of 291.24 g/mol. Its IUPAC name is 6-[4-fluoro-3-(trifluoromethyl)phenyl]piperidine-2-carboxylic acid.
| Compound Name | 6-[4-fluoro-3-(trifluoromethyl)phenyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 107290045 |
| Molecular Formula | C13H13F4NO2 |
| Molecular Weight | 291.24 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | 6-[4-fluoro-3-(trifluoromethyl)phenyl]piperidine-2-carboxylic acid |
| SMILES | O=C(O)C1CCCC(c2ccc(F)c(C(F)(F)F)c2)N1 |
| InChI | InChI=1S/C13H13F4NO2/c14-9-5-4-7(6-8(9)13(15,16)17)10-2-1-3-11(18-10)12(19)20/h4-6,10-11,18H,1-3H2,(H,19,20) |
| InChIKey | FVXZOAJKBQWBEJ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.24 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |