C17H17N3O2S — CID 142801737
2-(6-methoxy-1,2,3,4-tetrahydroquinolin-3-yl)-6H-thieno[2,3-b]pyrrole-5-carboxamide (PubChem CID 142801737) has the molecular formula C17H17N3O2S and a molecular weight of 327.41 g/mol. Its IUPAC name is 2-(6-methoxy-1,2,3,4-tetrahydroquinolin-3-yl)-6H-thieno[2,3-b]pyrrole-5-carboxamide.
| Compound Name | 2-(6-methoxy-1,2,3,4-tetrahydroquinolin-3-yl)-6H-thieno[2,3-b]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 142801737 |
| Molecular Formula | C17H17N3O2S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | 2-(6-methoxy-1,2,3,4-tetrahydroquinolin-3-yl)-6H-thieno[2,3-b]pyrrole-5-carboxamide |
| SMILES | COc1ccc2c(c1)CC(c1cc3cc(C(N)=O)[nH]c3s1)CN2 |
| InChI | InChI=1S/C17H17N3O2S/c1-22-12-2-3-13-9(5-12)4-11(8-19-13)15-7-10-6-14(16(18)21)20-17(10)23-15/h2-3,5-7,11,19-20H,4,8H2,1H3,(H2,18,21) |
| InChIKey | PCYYDMPVWNGXLZ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 80.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|