C16H20N2O3 — CID 10541365
ethyl 9-methoxy-4,4a,5,6-tetrahydro-3H-benzo[h][2,6]naphthyridine-2-carboxylate (PubChem CID 10541365) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is ethyl 9-methoxy-4,4a,5,6-tetrahydro-3H-benzo[h][2,6]naphthyridine-2-carboxylate.
| Compound Name | ethyl 9-methoxy-4,4a,5,6-tetrahydro-3H-benzo[h][2,6]naphthyridine-2-carboxylate |
|---|---|
| PubChem CID | 10541365 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | ethyl 9-methoxy-4,4a,5,6-tetrahydro-3H-benzo[h][2,6]naphthyridine-2-carboxylate |
| SMILES | CCOC(=O)N1C=C2c3cc(OC)ccc3NCC2CC1 |
| InChI | InChI=1S/C16H20N2O3/c1-3-21-16(19)18-7-6-11-9-17-15-5-4-12(20-2)8-13(15)14(11)10-18/h4-5,8,10-11,17H,3,6-7,9H2,1-2H3 |
| InChIKey | PFAIGFDYBSFHBZ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|