C18H21NO7 — CID 23220047
(E)-3-[3,3-bis(ethoxycarbonyl)-5-methoxy-1,2-dihydroindol-2-yl]prop-2-enoic acid (PubChem CID 23220047) has the molecular formula C18H21NO7 and a molecular weight of 363.37 g/mol. Its IUPAC name is (E)-3-[3,3-bis(ethoxycarbonyl)-5-methoxy-1,2-dihydroindol-2-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[3,3-bis(ethoxycarbonyl)-5-methoxy-1,2-dihydroindol-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 23220047 |
| Molecular Formula | C18H21NO7 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | (E)-3-[3,3-bis(ethoxycarbonyl)-5-methoxy-1,2-dihydroindol-2-yl]prop-2-enoic acid |
| SMILES | CCOC(=O)C1(C(=O)OCC)c2cc(OC)ccc2NC1/C=C/C(=O)O |
| InChI | InChI=1S/C18H21NO7/c1-4-25-16(22)18(17(23)26-5-2)12-10-11(24-3)6-7-13(12)19-14(18)8-9-15(20)21/h6-10,14,19H,4-5H2,1-3H3,(H,20,21)/b9-8+ |
| InChIKey | UNOMBUOXEKQDQB-CMDGGOBGSA-N |
| XLogP | 1.49 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|