C21H29NO4Si — CID 164685692
ethyl 3-[1-[tert-butyl(dimethyl)silyl]propa-1,2-dienyl]-5-methoxy-2-oxo-1H-indole-3-carboxylate (PubChem CID 164685692) has the molecular formula C21H29NO4Si and a molecular weight of 387.55 g/mol. Its IUPAC name is ethyl 3-[1-[tert-butyl(dimethyl)silyl]propa-1,2-dienyl]-5-methoxy-2-oxo-1H-indole-3-carboxylate.
| Compound Name | ethyl 3-[1-[tert-butyl(dimethyl)silyl]propa-1,2-dienyl]-5-methoxy-2-oxo-1H-indole-3-carboxylate |
|---|---|
| PubChem CID | 164685692 |
| Molecular Formula | C21H29NO4Si |
| Molecular Weight | 387.55 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | ethyl 3-[1-[tert-butyl(dimethyl)silyl]propa-1,2-dienyl]-5-methoxy-2-oxo-1H-indole-3-carboxylate |
| SMILES | C=C=C(C1(C(=O)OCC)C(=O)Nc2ccc(OC)cc21)[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H29NO4Si/c1-9-17(27(7,8)20(3,4)5)21(19(24)26-10-2)15-13-14(25-6)11-12-16(15)22-18(21)23/h11-13H,1,10H2,2-8H3,(H,22,23) |
| InChIKey | XIMCALRMPNJMOV-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.55 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|