C17H23NO3 — CID 102150650
ethyl (2R,3S,4R)-6-methoxy-3-methyl-4-[(E)-prop-1-enyl]-1,2,3,4-tetrahydroquinoline-2-carboxylate (PubChem CID 102150650) has the molecular formula C17H23NO3 and a molecular weight of 289.38 g/mol. Its IUPAC name is ethyl (2R,3S,4R)-6-methoxy-3-methyl-4-[(E)-prop-1-enyl]-1,2,3,4-tetrahydroquinoline-2-carboxylate.
| Compound Name | ethyl (2R,3S,4R)-6-methoxy-3-methyl-4-[(E)-prop-1-enyl]-1,2,3,4-tetrahydroquinoline-2-carboxylate |
|---|---|
| PubChem CID | 102150650 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | ethyl (2R,3S,4R)-6-methoxy-3-methyl-4-[(E)-prop-1-enyl]-1,2,3,4-tetrahydroquinoline-2-carboxylate |
| SMILES | C/C=C/[C@H]1c2cc(OC)ccc2N[C@@H](C(=O)OCC)[C@H]1C |
| InChI | InChI=1S/C17H23NO3/c1-5-7-13-11(3)16(17(19)21-6-2)18-15-9-8-12(20-4)10-14(13)15/h5,7-11,13,16,18H,6H2,1-4H3/b7-5+/t11-,13+,16+/m0/s1 |
| InChIKey | JVBMHXQLDMYTRI-FOGODEENSA-N |
| XLogP | 3.35 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|