C24H31ClN2O3 — CID 166058978
ethyl (2S,3R,4R)-4-(4-chloroanilino)-6-methoxy-3-pentyl-1,2,3,4-tetrahydroquinoline-2-carboxylate (PubChem CID 166058978) has the molecular formula C24H31ClN2O3 and a molecular weight of 430.98 g/mol. Its IUPAC name is ethyl (2S,3R,4R)-4-(4-chloroanilino)-6-methoxy-3-pentyl-1,2,3,4-tetrahydroquinoline-2-carboxylate.
| Compound Name | ethyl (2S,3R,4R)-4-(4-chloroanilino)-6-methoxy-3-pentyl-1,2,3,4-tetrahydroquinoline-2-carboxylate |
|---|---|
| PubChem CID | 166058978 |
| Molecular Formula | C24H31ClN2O3 |
| Molecular Weight | 430.98 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | ethyl (2S,3R,4R)-4-(4-chloroanilino)-6-methoxy-3-pentyl-1,2,3,4-tetrahydroquinoline-2-carboxylate |
| SMILES | CCCCC[C@H]1[C@@H](C(=O)OCC)Nc2ccc(OC)cc2[C@@H]1Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H31ClN2O3/c1-4-6-7-8-19-22(26-17-11-9-16(25)10-12-17)20-15-18(29-3)13-14-21(20)27-23(19)24(28)30-5-2/h9-15,19,22-23,26-27H,4-8H2,1-3H3/t19-,22-,23+/m1/s1 |
| InChIKey | NFCFMGAHBZXQAZ-PTUXOGIPSA-N |
| XLogP | 6.06 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.98 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|