C16H20N4O3 — CID 166059011
ethyl (2S,3S,4R)-4-azido-6-methoxy-3-prop-2-enyl-1,2,3,4-tetrahydroquinoline-2-carboxylate (PubChem CID 166059011) has the molecular formula C16H20N4O3 and a molecular weight of 316.36 g/mol. Its IUPAC name is ethyl (2S,3S,4R)-4-azido-6-methoxy-3-prop-2-enyl-1,2,3,4-tetrahydroquinoline-2-carboxylate.
| Compound Name | ethyl (2S,3S,4R)-4-azido-6-methoxy-3-prop-2-enyl-1,2,3,4-tetrahydroquinoline-2-carboxylate |
|---|---|
| PubChem CID | 166059011 |
| Molecular Formula | C16H20N4O3 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | ethyl (2S,3S,4R)-4-azido-6-methoxy-3-prop-2-enyl-1,2,3,4-tetrahydroquinoline-2-carboxylate |
| SMILES | C=CC[C@H]1[C@@H](C(=O)OCC)Nc2ccc(OC)cc2[C@@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C16H20N4O3/c1-4-6-11-14(19-20-17)12-9-10(22-3)7-8-13(12)18-15(11)16(21)23-5-2/h4,7-9,11,14-15,18H,1,5-6H2,2-3H3/t11-,14-,15+/m1/s1 |
| InChIKey | XVSXGOZVWPBZKH-DFBGVHRSSA-N |
| XLogP | 3.60 |
| TPSA | 96.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|