C19H25NO4 — CID 166139136
ethyl (2S)-6-methoxy-3-prop-2-enyl-1,2,3,4-tetrahydroquinoline-2-carboxylate;prop-2-yn-1-ol (PubChem CID 166139136) has the molecular formula C19H25NO4 and a molecular weight of 331.41 g/mol. Its IUPAC name is ethyl (2S)-6-methoxy-3-prop-2-enyl-1,2,3,4-tetrahydroquinoline-2-carboxylate;prop-2-yn-1-ol.
| Compound Name | ethyl (2S)-6-methoxy-3-prop-2-enyl-1,2,3,4-tetrahydroquinoline-2-carboxylate;prop-2-yn-1-ol |
|---|---|
| PubChem CID | 166139136 |
| Molecular Formula | C19H25NO4 |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | ethyl (2S)-6-methoxy-3-prop-2-enyl-1,2,3,4-tetrahydroquinoline-2-carboxylate;prop-2-yn-1-ol |
| SMILES | C#CCO.C=CCC1Cc2cc(OC)ccc2N[C@@H]1C(=O)OCC |
| InChI | InChI=1S/C16H21NO3.C3H4O/c1-4-6-11-9-12-10-13(19-3)7-8-14(12)17-15(11)16(18)20-5-2;1-2-3-4/h4,7-8,10-11,15,17H,1,5-6,9H2,2-3H3;1,4H,3H2/t11?,15-;/m0./s1 |
| InChIKey | SMSXVNIEDPYHFL-XEKVDKDVSA-N |
| XLogP | 2.40 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|