C11H15FN2 — CID 105448210
N-ethyl-7-fluoro-1,2,3,4-tetrahydroquinolin-3-amine (PubChem CID 105448210) has the molecular formula C11H15FN2 and a molecular weight of 194.25 g/mol. Its IUPAC name is N-ethyl-7-fluoro-1,2,3,4-tetrahydroquinolin-3-amine.
| Compound Name | N-ethyl-7-fluoro-1,2,3,4-tetrahydroquinolin-3-amine |
|---|---|
| PubChem CID | 105448210 |
| Molecular Formula | C11H15FN2 |
| Molecular Weight | 194.25 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | N-ethyl-7-fluoro-1,2,3,4-tetrahydroquinolin-3-amine |
| SMILES | CCNC1CNc2cc(F)ccc2C1 |
| InChI | InChI=1S/C11H15FN2/c1-2-13-10-5-8-3-4-9(12)6-11(8)14-7-10/h3-4,6,10,13-14H,2,5,7H2,1H3 |
| InChIKey | GLHYMOKBJPNSSF-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.25 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |