C11H13NO — CID 102526168
2-prop-2-enyl-2,3-dihydro-1H-indol-5-ol (PubChem CID 102526168) has the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. Its IUPAC name is 2-prop-2-enyl-2,3-dihydro-1H-indol-5-ol.
| Compound Name | 2-prop-2-enyl-2,3-dihydro-1H-indol-5-ol |
|---|---|
| PubChem CID | 102526168 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | 2-prop-2-enyl-2,3-dihydro-1H-indol-5-ol |
| SMILES | C=CCC1Cc2cc(O)ccc2N1 |
| InChI | InChI=1S/C11H13NO/c1-2-3-9-6-8-7-10(13)4-5-11(8)12-9/h2,4-5,7,9,12-13H,1,3,6H2 |
| InChIKey | QMOJQMGTCSABHK-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|