C11H16N2O — CID 105446256
2-(methylaminomethyl)-1,2,3,4-tetrahydroquinolin-6-ol (PubChem CID 105446256) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is 2-(methylaminomethyl)-1,2,3,4-tetrahydroquinolin-6-ol.
| Compound Name | 2-(methylaminomethyl)-1,2,3,4-tetrahydroquinolin-6-ol |
|---|---|
| PubChem CID | 105446256 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | 2-(methylaminomethyl)-1,2,3,4-tetrahydroquinolin-6-ol |
| SMILES | CNCC1CCc2cc(O)ccc2N1 |
| InChI | InChI=1S/C11H16N2O/c1-12-7-9-3-2-8-6-10(14)4-5-11(8)13-9/h4-6,9,12-14H,2-3,7H2,1H3 |
| InChIKey | IMMFXWPMQQEDEA-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|