C11H16N2O — CID 105446246
3-(methylaminomethyl)-1,2,3,4-tetrahydroisoquinolin-7-ol (PubChem CID 105446246) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is 3-(methylaminomethyl)-1,2,3,4-tetrahydroisoquinolin-7-ol.
| Compound Name | 3-(methylaminomethyl)-1,2,3,4-tetrahydroisoquinolin-7-ol |
|---|---|
| PubChem CID | 105446246 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | 3-(methylaminomethyl)-1,2,3,4-tetrahydroisoquinolin-7-ol |
| SMILES | CNCC1Cc2ccc(O)cc2CN1 |
| InChI | InChI=1S/C11H16N2O/c1-12-7-10-4-8-2-3-11(14)5-9(8)6-13-10/h2-3,5,10,12-14H,4,6-7H2,1H3 |
| InChIKey | UWLADCQLBQMHPW-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |