C16H18N2O2S — CID 169095610
2-phenyl-6-[(sulfinoamino)methyl]-1,2,3,4-tetrahydroquinoline (PubChem CID 169095610) has the molecular formula C16H18N2O2S and a molecular weight of 302.40 g/mol. Its IUPAC name is 2-phenyl-6-[(sulfinoamino)methyl]-1,2,3,4-tetrahydroquinoline.
| Compound Name | 2-phenyl-6-[(sulfinoamino)methyl]-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 169095610 |
| Molecular Formula | C16H18N2O2S |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | 2-phenyl-6-[(sulfinoamino)methyl]-1,2,3,4-tetrahydroquinoline |
| SMILES | O=S(O)NCc1ccc2c(c1)CCC(c1ccccc1)N2 |
| InChI | InChI=1S/C16H18N2O2S/c19-21(20)17-11-12-6-8-16-14(10-12)7-9-15(18-16)13-4-2-1-3-5-13/h1-6,8,10,15,17-18H,7,9,11H2,(H,19,20) |
| InChIKey | RNKHAKNINQAKCL-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|