C11H15BrN2 — CID 83866994
1-(5-bromo-2,3-dihydro-1H-indol-3-yl)-N-methylethanamine (PubChem CID 83866994) has the molecular formula C11H15BrN2 and a molecular weight of 255.16 g/mol. Its IUPAC name is 1-(5-bromo-2,3-dihydro-1H-indol-3-yl)-N-methylethanamine.
| Compound Name | 1-(5-bromo-2,3-dihydro-1H-indol-3-yl)-N-methylethanamine |
|---|---|
| PubChem CID | 83866994 |
| Molecular Formula | C11H15BrN2 |
| Molecular Weight | 255.16 g/mol |
| Exact Mass | 254.04 |
| IUPAC Name | 1-(5-bromo-2,3-dihydro-1H-indol-3-yl)-N-methylethanamine |
| SMILES | CNC(C)C1CNc2ccc(Br)cc21 |
| InChI | InChI=1S/C11H15BrN2/c1-7(13-2)10-6-14-11-4-3-8(12)5-9(10)11/h3-5,7,10,13-14H,6H2,1-2H3 |
| InChIKey | PMDWPKPNTCLKDK-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.16 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |