C19H22O — CID 166479863
ethane;4-(3-methylphenyl)-3,4-dihydro-1H-naphthalen-2-one (PubChem CID 166479863) has the molecular formula C19H22O and a molecular weight of 266.38 g/mol. Its IUPAC name is ethane;4-(3-methylphenyl)-3,4-dihydro-1H-naphthalen-2-one.
| Compound Name | ethane;4-(3-methylphenyl)-3,4-dihydro-1H-naphthalen-2-one |
|---|---|
| PubChem CID | 166479863 |
| Molecular Formula | C19H22O |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | ethane;4-(3-methylphenyl)-3,4-dihydro-1H-naphthalen-2-one |
| SMILES | CC.Cc1cccc(C2CC(=O)Cc3ccccc32)c1 |
| InChI | InChI=1S/C17H16O.C2H6/c1-12-5-4-7-13(9-12)17-11-15(18)10-14-6-2-3-8-16(14)17;1-2/h2-9,17H,10-11H2,1H3;1-2H3 |
| InChIKey | KTSDYMOCSPYYAH-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |