C10H9IO — CID 138626469
4-iodo-3,4-dihydro-1H-naphthalen-2-one (PubChem CID 138626469) has the molecular formula C10H9IO and a molecular weight of 272.08 g/mol. Its IUPAC name is 4-iodo-3,4-dihydro-1H-naphthalen-2-one.
| Compound Name | 4-iodo-3,4-dihydro-1H-naphthalen-2-one |
|---|---|
| PubChem CID | 138626469 |
| Molecular Formula | C10H9IO |
| Molecular Weight | 272.08 g/mol |
| Exact Mass | 271.97 |
| IUPAC Name | 4-iodo-3,4-dihydro-1H-naphthalen-2-one |
| SMILES | O=C1Cc2ccccc2C(I)C1 |
| InChI | InChI=1S/C10H9IO/c11-10-6-8(12)5-7-3-1-2-4-9(7)10/h1-4,10H,5-6H2 |
| InChIKey | CRVHFZYGEDLZDZ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.08 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|