C15H10Cl3F — CID 129405694
(1R,3S)-3-chloro-1-(3,4-dichlorophenyl)-5-fluoro-2,3-dihydro-1H-indene (PubChem CID 129405694) has the molecular formula C15H10Cl3F and a molecular weight of 315.60 g/mol. Its IUPAC name is (1R,3S)-3-chloro-1-(3,4-dichlorophenyl)-5-fluoro-2,3-dihydro-1H-indene.
| Compound Name | (1R,3S)-3-chloro-1-(3,4-dichlorophenyl)-5-fluoro-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 129405694 |
| Molecular Formula | C15H10Cl3F |
| Molecular Weight | 315.60 g/mol |
| Exact Mass | 313.98 |
| IUPAC Name | (1R,3S)-3-chloro-1-(3,4-dichlorophenyl)-5-fluoro-2,3-dihydro-1H-indene |
| SMILES | Fc1ccc2c(c1)[C@@H](Cl)C[C@@H]2c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H10Cl3F/c16-13-4-1-8(5-15(13)18)11-7-14(17)12-6-9(19)2-3-10(11)12/h1-6,11,14H,7H2/t11-,14+/m1/s1 |
| InChIKey | BZHYRJBFMAABAK-RISCZKNCSA-N |
| XLogP | 5.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.60 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|