C16H14F2O3S — CID 125481391
[(1R,3S)-6-fluoro-3-(4-fluorophenyl)-2,3-dihydro-1H-inden-1-yl] methanesulfonate (PubChem CID 125481391) has the molecular formula C16H14F2O3S and a molecular weight of 324.35 g/mol. Its IUPAC name is [(1R,3S)-6-fluoro-3-(4-fluorophenyl)-2,3-dihydro-1H-inden-1-yl] methanesulfonate.
| Compound Name | [(1R,3S)-6-fluoro-3-(4-fluorophenyl)-2,3-dihydro-1H-inden-1-yl] methanesulfonate |
|---|---|
| PubChem CID | 125481391 |
| Molecular Formula | C16H14F2O3S |
| Molecular Weight | 324.35 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | [(1R,3S)-6-fluoro-3-(4-fluorophenyl)-2,3-dihydro-1H-inden-1-yl] methanesulfonate |
| SMILES | CS(=O)(=O)O[C@@H]1C[C@@H](c2ccc(F)cc2)c2ccc(F)cc21 |
| InChI | InChI=1S/C16H14F2O3S/c1-22(19,20)21-16-9-14(10-2-4-11(17)5-3-10)13-7-6-12(18)8-15(13)16/h2-8,14,16H,9H2,1H3/t14-,16+/m0/s1 |
| InChIKey | MJPUTKPZXULSJY-GOEBONIOSA-N |
| XLogP | 3.52 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.35 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|