C16H15FO — CID 129390819
(1S,3R)-3-(4-fluorophenyl)-5-methyl-2,3-dihydro-1H-inden-1-ol (PubChem CID 129390819) has the molecular formula C16H15FO and a molecular weight of 242.29 g/mol. Its IUPAC name is (1S,3R)-3-(4-fluorophenyl)-5-methyl-2,3-dihydro-1H-inden-1-ol.
| Compound Name | (1S,3R)-3-(4-fluorophenyl)-5-methyl-2,3-dihydro-1H-inden-1-ol |
|---|---|
| PubChem CID | 129390819 |
| Molecular Formula | C16H15FO |
| Molecular Weight | 242.29 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | (1S,3R)-3-(4-fluorophenyl)-5-methyl-2,3-dihydro-1H-inden-1-ol |
| SMILES | Cc1ccc2c(c1)[C@@H](c1ccc(F)cc1)C[C@@H]2O |
| InChI | InChI=1S/C16H15FO/c1-10-2-7-13-15(8-10)14(9-16(13)18)11-3-5-12(17)6-4-11/h2-8,14,16,18H,9H2,1H3/t14-,16+/m1/s1 |
| InChIKey | IORSZPSGJDYADW-ZBFHGGJFSA-N |
| XLogP | 3.70 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.29 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |