About (1S,3S)-3-(4-fluorophenyl)-5-(trifluoromethyl)-2,3-dihydro-1H-inden-1-ol
(1S,3S)-3-(4-fluorophenyl)-5-(trifluoromethyl)-2,3-dihydro-1H-inden-1-ol (PubChem CID 131848103) has the molecular formula C16H12F4O
and a molecular weight of 296.26 g/mol. Its IUPAC name is (1S,3S)-3-(4-fluorophenyl)-5-(trifluoromethyl)-2,3-dihydro-1H-inden-1-ol.
Molecular Properties
| Compound Name | (1S,3S)-3-(4-fluorophenyl)-5-(trifluoromethyl)-2,3-dihydro-1H-inden-1-ol |
| PubChem CID | 131848103 |
| Molecular Formula | C16H12F4O |
| Molecular Weight | 296.26 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | (1S,3S)-3-(4-fluorophenyl)-5-(trifluoromethyl)-2,3-dihydro-1H-inden-1-ol |
| SMILES | O[C@H]1C[C@@H](c2ccc(F)cc2)c2cc(C(F)(F)F)ccc21 |
| InChI | InChI=1S/C16H12F4O/c17-11-4-1-9(2-5-11)13-8-15(21)12-6-3-10(7-14(12)13)16(18,19)20/h1-7,13,15,21H,8H2/t13-,15-/m0/s1 |
| InChIKey | DKUQYUUVDRILGP-ZFWWWQNUSA-N |
| XLogP | 4.41 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.26 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (1S,3S)-3-(4-fluorophenyl)-5-(trifluoromethyl)-2,3-dihydro-1H-inden-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,3S)-3-(4-fluorophenyl)-5-(trifluoromethyl)-2,3-dihydro-1H-inden-1-ol?
The IUPAC name of (1S,3S)-3-(4-fluorophenyl)-5-(trifluoromethyl)-2,3-dihydro-1H-inden-1-ol (CID 131848103) is (1S,3S)-3-(4-fluorophenyl)-5-(trifluoromethyl)-2,3-dihydro-1H-inden-1-ol.
What is the SMILES notation for (1S,3S)-3-(4-fluorophenyl)-5-(trifluoromethyl)-2,3-dihydro-1H-inden-1-ol?
The canonical SMILES for (1S,3S)-3-(4-fluorophenyl)-5-(trifluoromethyl)-2,3-dihydro-1H-inden-1-ol is O[C@H]1C[C@@H](c2ccc(F)cc2)c2cc(C(F)(F)F)ccc21.
What is the InChIKey of (1S,3S)-3-(4-fluorophenyl)-5-(trifluoromethyl)-2,3-dihydro-1H-inden-1-ol?
The InChIKey is DKUQYUUVDRILGP-ZFWWWQNUSA-N. The full InChI is InChI=1S/C16H12F4O/c17-11-4-1-9(2-5-11)13-8-15(21)12-6-3-10(7-14(12)13)16(18,19)20/h1-7,13,15,21H,8H2/t13-,15-/m0/s1.
What are the key properties of (1S,3S)-3-(4-fluorophenyl)-5-(trifluoromethyl)-2,3-dihydro-1H-inden-1-ol?
(1S,3S)-3-(4-fluorophenyl)-5-(trifluoromethyl)-2,3-dihydro-1H-inden-1-ol has a molecular weight of 296.26 g/mol, XLogP of 4.41, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,3S)-3-(4-fluorophenyl)-5-(trifluoromethyl)-2,3-dihydro-1H-inden-1-ol is sourced from PubChem (CID 131848103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).