C16H13Cl3O — CID 131864192
(1S,3S)-3-chloro-1-(3,4-dichlorophenyl)-5-methoxy-2,3-dihydro-1H-indene (PubChem CID 131864192) has the molecular formula C16H13Cl3O and a molecular weight of 327.64 g/mol. Its IUPAC name is (1S,3S)-3-chloro-1-(3,4-dichlorophenyl)-5-methoxy-2,3-dihydro-1H-indene.
| Compound Name | (1S,3S)-3-chloro-1-(3,4-dichlorophenyl)-5-methoxy-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 131864192 |
| Molecular Formula | C16H13Cl3O |
| Molecular Weight | 327.64 g/mol |
| Exact Mass | 326.00 |
| IUPAC Name | (1S,3S)-3-chloro-1-(3,4-dichlorophenyl)-5-methoxy-2,3-dihydro-1H-indene |
| SMILES | COc1ccc2c(c1)[C@@H](Cl)C[C@H]2c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H13Cl3O/c1-20-10-3-4-11-12(8-15(18)13(11)7-10)9-2-5-14(17)16(19)6-9/h2-7,12,15H,8H2,1H3/t12-,15-/m0/s1 |
| InChIKey | WUTRFNUVYHBGAJ-WFASDCNBSA-N |
| XLogP | 5.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.64 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|