C24H23Cl2NO — CID 69189375
(1R,4R)-4-(3,4-dichlorophenyl)-N-[(4-methoxyphenyl)methyl]-1,2,3,4-tetrahydronaphthalen-1-amine (PubChem CID 69189375) has the molecular formula C24H23Cl2NO and a molecular weight of 412.36 g/mol. Its IUPAC name is (1R,4R)-4-(3,4-dichlorophenyl)-N-[(4-methoxyphenyl)methyl]-1,2,3,4-tetrahydronaphthalen-1-amine.
| Compound Name | (1R,4R)-4-(3,4-dichlorophenyl)-N-[(4-methoxyphenyl)methyl]-1,2,3,4-tetrahydronaphthalen-1-amine |
|---|---|
| PubChem CID | 69189375 |
| Molecular Formula | C24H23Cl2NO |
| Molecular Weight | 412.36 g/mol |
| Exact Mass | 411.12 |
| IUPAC Name | (1R,4R)-4-(3,4-dichlorophenyl)-N-[(4-methoxyphenyl)methyl]-1,2,3,4-tetrahydronaphthalen-1-amine |
| SMILES | COc1ccc(CN[C@@H]2CC[C@H](c3ccc(Cl)c(Cl)c3)c3ccccc32)cc1 |
| InChI | InChI=1S/C24H23Cl2NO/c1-28-18-9-6-16(7-10-18)15-27-24-13-11-19(20-4-2-3-5-21(20)24)17-8-12-22(25)23(26)14-17/h2-10,12,14,19,24,27H,11,13,15H2,1H3/t19-,24-/m1/s1 |
| InChIKey | WVCVCXUASJYKQR-NTKDMRAZSA-N |
| XLogP | 6.76 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.36 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |