C20H24Cl2N2 — CID 164629050
N'-[(1R,4S)-4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydronaphthalen-1-yl]butane-1,4-diamine (PubChem CID 164629050) has the molecular formula C20H24Cl2N2 and a molecular weight of 363.33 g/mol. Its IUPAC name is N'-[(1R,4S)-4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydronaphthalen-1-yl]butane-1,4-diamine.
| Compound Name | N'-[(1R,4S)-4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydronaphthalen-1-yl]butane-1,4-diamine |
|---|---|
| PubChem CID | 164629050 |
| Molecular Formula | C20H24Cl2N2 |
| Molecular Weight | 363.33 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | N'-[(1R,4S)-4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydronaphthalen-1-yl]butane-1,4-diamine |
| SMILES | NCCCCN[C@@H]1CC[C@@H](c2ccc(Cl)c(Cl)c2)c2ccccc21 |
| InChI | InChI=1S/C20H24Cl2N2/c21-18-9-7-14(13-19(18)22)15-8-10-20(24-12-4-3-11-23)17-6-2-1-5-16(15)17/h1-2,5-7,9,13,15,20,24H,3-4,8,10-12,23H2/t15-,20+/m0/s1 |
| InChIKey | HECDWHDJGKRBCA-MGPUTAFESA-N |
| XLogP | 5.29 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.33 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|