C21H22Cl2N2O4-2 — CID 86758829
(2S)-2-aminobutanedioate;(1S,4S)-4-(3,4-dichlorophenyl)-N-methyl-1,2,3,4-tetrahydronaphthalen-1-amine (PubChem CID 86758829) has the molecular formula C21H22Cl2N2O4-2 and a molecular weight of 437.32 g/mol. Its IUPAC name is (2S)-2-aminobutanedioate;(1S,4S)-4-(3,4-dichlorophenyl)-N-methyl-1,2,3,4-tetrahydronaphthalen-1-amine.
| Compound Name | (2S)-2-aminobutanedioate;(1S,4S)-4-(3,4-dichlorophenyl)-N-methyl-1,2,3,4-tetrahydronaphthalen-1-amine |
|---|---|
| PubChem CID | 86758829 |
| Molecular Formula | C21H22Cl2N2O4-2 |
| Molecular Weight | 437.32 g/mol |
| Exact Mass | 436.10 |
| IUPAC Name | (2S)-2-aminobutanedioate;(1S,4S)-4-(3,4-dichlorophenyl)-N-methyl-1,2,3,4-tetrahydronaphthalen-1-amine |
| SMILES | CN[C@H]1CC[C@@H](c2ccc(Cl)c(Cl)c2)c2ccccc21.N[C@@H](CC(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C17H17Cl2N.C4H7NO4/c1-20-17-9-7-12(13-4-2-3-5-14(13)17)11-6-8-15(18)16(19)10-11;5-2(4(8)9)1-3(6)7/h2-6,8,10,12,17,20H,7,9H2,1H3;2H,1,5H2,(H,6,7)(H,8,9)/p-2/t12-,17-;2-/m00/s1 |
| InChIKey | DWJLGOHTNZITFF-KOFRPKGESA-L |
| XLogP | 1.38 |
| TPSA | 118.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.32 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |