C24H25Cl2NO3S — CID 10073777
(1S,4S)-4-(3,4-dichlorophenyl)-N-methyl-1,2,3,4-tetrahydronaphthalen-1-amine;4-methylbenzenesulfonic acid (PubChem CID 10073777) has the molecular formula C24H25Cl2NO3S and a molecular weight of 478.44 g/mol. Its IUPAC name is (1S,4S)-4-(3,4-dichlorophenyl)-N-methyl-1,2,3,4-tetrahydronaphthalen-1-amine;4-methylbenzenesulfonic acid.
| Compound Name | (1S,4S)-4-(3,4-dichlorophenyl)-N-methyl-1,2,3,4-tetrahydronaphthalen-1-amine;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 10073777 |
| Molecular Formula | C24H25Cl2NO3S |
| Molecular Weight | 478.44 g/mol |
| Exact Mass | 477.09 |
| IUPAC Name | (1S,4S)-4-(3,4-dichlorophenyl)-N-methyl-1,2,3,4-tetrahydronaphthalen-1-amine;4-methylbenzenesulfonic acid |
| SMILES | CN[C@H]1CC[C@@H](c2ccc(Cl)c(Cl)c2)c2ccccc21.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C17H17Cl2N.C7H8O3S/c1-20-17-9-7-12(13-4-2-3-5-14(13)17)11-6-8-15(18)16(19)10-11;1-6-2-4-7(5-3-6)11(8,9)10/h2-6,8,10,12,17,20H,7,9H2,1H3;2-5H,1H3,(H,8,9,10)/t12-,17-;/m0./s1 |
| InChIKey | OCRKCAVVBSBTRF-XHXSRVRCSA-N |
| XLogP | 6.42 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.44 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|