C19H21Cl2NO2S — CID 58129674
(1S,4S)-4-(3,4-dichlorophenyl)-N-methyl-7-(methylsulfonylmethyl)-1,2,3,4-tetrahydronaphthalen-1-amine (PubChem CID 58129674) has the molecular formula C19H21Cl2NO2S and a molecular weight of 398.36 g/mol. Its IUPAC name is (1S,4S)-4-(3,4-dichlorophenyl)-N-methyl-7-(methylsulfonylmethyl)-1,2,3,4-tetrahydronaphthalen-1-amine.
| Compound Name | (1S,4S)-4-(3,4-dichlorophenyl)-N-methyl-7-(methylsulfonylmethyl)-1,2,3,4-tetrahydronaphthalen-1-amine |
|---|---|
| PubChem CID | 58129674 |
| Molecular Formula | C19H21Cl2NO2S |
| Molecular Weight | 398.36 g/mol |
| Exact Mass | 397.07 |
| IUPAC Name | (1S,4S)-4-(3,4-dichlorophenyl)-N-methyl-7-(methylsulfonylmethyl)-1,2,3,4-tetrahydronaphthalen-1-amine |
| SMILES | CN[C@H]1CC[C@@H](c2ccc(Cl)c(Cl)c2)c2ccc(CS(C)(=O)=O)cc21 |
| InChI | InChI=1S/C19H21Cl2NO2S/c1-22-19-8-6-14(13-4-7-17(20)18(21)10-13)15-5-3-12(9-16(15)19)11-25(2,23)24/h3-5,7,9-10,14,19,22H,6,8,11H2,1-2H3/t14-,19-/m0/s1 |
| InChIKey | DRSFDBXRWVAPRL-LIRRHRJNSA-N |
| XLogP | 4.72 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.36 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |