C20H21Cl2NS — CID 58129631
1-[(5S,8S)-5-(3,4-dichlorophenyl)-8-(methylamino)-5,6,7,8-tetrahydronaphthalen-2-yl]propane-2-thione (PubChem CID 58129631) has the molecular formula C20H21Cl2NS and a molecular weight of 378.37 g/mol. Its IUPAC name is 1-[(5S,8S)-5-(3,4-dichlorophenyl)-8-(methylamino)-5,6,7,8-tetrahydronaphthalen-2-yl]propane-2-thione.
| Compound Name | 1-[(5S,8S)-5-(3,4-dichlorophenyl)-8-(methylamino)-5,6,7,8-tetrahydronaphthalen-2-yl]propane-2-thione |
|---|---|
| PubChem CID | 58129631 |
| Molecular Formula | C20H21Cl2NS |
| Molecular Weight | 378.37 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | 1-[(5S,8S)-5-(3,4-dichlorophenyl)-8-(methylamino)-5,6,7,8-tetrahydronaphthalen-2-yl]propane-2-thione |
| SMILES | CN[C@H]1CC[C@@H](c2ccc(Cl)c(Cl)c2)c2ccc(CC(C)=S)cc21 |
| InChI | InChI=1S/C20H21Cl2NS/c1-12(24)9-13-3-5-16-15(6-8-20(23-2)17(16)10-13)14-4-7-18(21)19(22)11-14/h3-5,7,10-11,15,20,23H,6,8-9H2,1-2H3/t15-,20-/m0/s1 |
| InChIKey | CXSQXKBUAZERIA-YWZLYKJASA-N |
| XLogP | 6.11 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.37 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|